C10H22O5Si — CID 141215951
ethyl-dimethoxy-[(2-methyl-1,3-dioxan-2-yl)methoxy]silane (PubChem CID 141215951) has the molecular formula C10H22O5Si and a molecular weight of 250.37 g/mol. Its IUPAC name is ethyl-dimethoxy-[(2-methyl-1,3-dioxan-2-yl)methoxy]silane.
| Compound Name | ethyl-dimethoxy-[(2-methyl-1,3-dioxan-2-yl)methoxy]silane |
|---|---|
| PubChem CID | 141215951 |
| Molecular Formula | C10H22O5Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl-dimethoxy-[(2-methyl-1,3-dioxan-2-yl)methoxy]silane |
| SMILES | CC[Si](OC)(OC)OCC1(C)OCCCO1 |
| InChI | InChI=1S/C10H22O5Si/c1-5-16(11-3,12-4)15-9-10(2)13-7-6-8-14-10/h5-9H2,1-4H3 |
| InChIKey | CHQGRIZJPKWKLZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|