C11H23ClO4Si — CID 141250184
chloromethoxy-(2-ethyl-1,3-dioxan-2-yl)-methoxy-propylsilane (PubChem CID 141250184) has the molecular formula C11H23ClO4Si and a molecular weight of 282.84 g/mol. Its IUPAC name is chloromethoxy-(2-ethyl-1,3-dioxan-2-yl)-methoxy-propylsilane.
| Compound Name | chloromethoxy-(2-ethyl-1,3-dioxan-2-yl)-methoxy-propylsilane |
|---|---|
| PubChem CID | 141250184 |
| Molecular Formula | C11H23ClO4Si |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | chloromethoxy-(2-ethyl-1,3-dioxan-2-yl)-methoxy-propylsilane |
| SMILES | CCC[Si](OC)(OCCl)C1(CC)OCCCO1 |
| InChI | InChI=1S/C11H23ClO4Si/c1-4-9-17(13-3,16-10-12)11(5-2)14-7-6-8-15-11/h4-10H2,1-3H3 |
| InChIKey | WBINQRVIIHRUNE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|