C18H38O5Si — CID 141199986
2-(2-ethyl-1,3-dioxan-2-yl)propan-2-yloxy-di(propan-2-yloxy)-propylsilane (PubChem CID 141199986) has the molecular formula C18H38O5Si and a molecular weight of 362.58 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-dioxan-2-yl)propan-2-yloxy-di(propan-2-yloxy)-propylsilane.
| Compound Name | 2-(2-ethyl-1,3-dioxan-2-yl)propan-2-yloxy-di(propan-2-yloxy)-propylsilane |
|---|---|
| PubChem CID | 141199986 |
| Molecular Formula | C18H38O5Si |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-(2-ethyl-1,3-dioxan-2-yl)propan-2-yloxy-di(propan-2-yloxy)-propylsilane |
| SMILES | CCC[Si](OC(C)C)(OC(C)C)OC(C)(C)C1(CC)OCCCO1 |
| InChI | InChI=1S/C18H38O5Si/c1-9-14-24(21-15(3)4,22-16(5)6)23-17(7,8)18(10-2)19-12-11-13-20-18/h15-16H,9-14H2,1-8H3 |
| InChIKey | XUCAVRRBIVDPKT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|