C13H26Cl2O2Si — CID 141250407
dichloro-[1-(2-ethyl-1,3-dioxan-2-yl)butyl]-propylsilane (PubChem CID 141250407) has the molecular formula C13H26Cl2O2Si and a molecular weight of 313.34 g/mol. Its IUPAC name is dichloro-[1-(2-ethyl-1,3-dioxan-2-yl)butyl]-propylsilane.
| Compound Name | dichloro-[1-(2-ethyl-1,3-dioxan-2-yl)butyl]-propylsilane |
|---|---|
| PubChem CID | 141250407 |
| Molecular Formula | C13H26Cl2O2Si |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | dichloro-[1-(2-ethyl-1,3-dioxan-2-yl)butyl]-propylsilane |
| SMILES | CCCC(C1(CC)OCCCO1)[Si](Cl)(Cl)CCC |
| InChI | InChI=1S/C13H26Cl2O2Si/c1-4-8-12(18(14,15)11-5-2)13(6-3)16-9-7-10-17-13/h12H,4-11H2,1-3H3 |
| InChIKey | PWBDBLDPQUJECL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|