C19H40O2Si — CID 168875222
1-(2-ethyl-1,3-dioxan-2-yl)octyl-dimethyl-propylsilane (PubChem CID 168875222) has the molecular formula C19H40O2Si and a molecular weight of 328.61 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-dioxan-2-yl)octyl-dimethyl-propylsilane.
| Compound Name | 1-(2-ethyl-1,3-dioxan-2-yl)octyl-dimethyl-propylsilane |
|---|---|
| PubChem CID | 168875222 |
| Molecular Formula | C19H40O2Si |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 1-(2-ethyl-1,3-dioxan-2-yl)octyl-dimethyl-propylsilane |
| SMILES | CCCCCCCC(C1(CC)OCCCO1)[Si](C)(C)CCC |
| InChI | InChI=1S/C19H40O2Si/c1-6-9-10-11-12-14-18(22(4,5)17-7-2)19(8-3)20-15-13-16-21-19/h18H,6-17H2,1-5H3 |
| InChIKey | JAGVJPMROKNCRE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|