C18H32O10Si — CID 141340334
[diacetyloxy-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl]silyl] acetate (PubChem CID 141340334) has the molecular formula C18H32O10Si and a molecular weight of 436.53 g/mol. Its IUPAC name is [diacetyloxy-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl]silyl] acetate.
| Compound Name | [diacetyloxy-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl]silyl] acetate |
|---|---|
| PubChem CID | 141340334 |
| Molecular Formula | C18H32O10Si |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [diacetyloxy-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl]silyl] acetate |
| SMILES | CCC(OC(CC)[Si](OC(C)=O)(OC(C)=O)OC(C)=O)OC1(CC)OCCCO1 |
| InChI | InChI=1S/C18H32O10Si/c1-7-16(25-18(9-3)22-11-10-12-23-18)24-17(8-2)29(26-13(4)19,27-14(5)20)28-15(6)21/h16-17H,7-12H2,1-6H3 |
| InChIKey | NKOUYHCSRRGMKT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|