C17H36O7Si — CID 141339674
1-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]ethoxy]propyl-dimethoxy-methylsilane (PubChem CID 141339674) has the molecular formula C17H36O7Si and a molecular weight of 380.55 g/mol. Its IUPAC name is 1-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]ethoxy]propyl-dimethoxy-methylsilane.
| Compound Name | 1-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]ethoxy]propyl-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 141339674 |
| Molecular Formula | C17H36O7Si |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-[1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]ethoxy]propyl-dimethoxy-methylsilane |
| SMILES | CCC(OC(C)OC(CC)[Si](C)(OC)OC)OC1(CC)OCCCO1 |
| InChI | InChI=1S/C17H36O7Si/c1-8-15(24-17(10-3)20-12-11-13-21-17)22-14(4)23-16(9-2)25(7,18-5)19-6/h14-16H,8-13H2,1-7H3 |
| InChIKey | BGHVXZNRGGNDBC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|