C21H44O6Si — CID 141340330
1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-(1-methoxyethoxy)-di(propan-2-yl)silane (PubChem CID 141340330) has the molecular formula C21H44O6Si and a molecular weight of 420.66 g/mol. Its IUPAC name is 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-(1-methoxyethoxy)-di(propan-2-yl)silane.
| Compound Name | 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-(1-methoxyethoxy)-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 141340330 |
| Molecular Formula | C21H44O6Si |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-[1-[(2-ethyl-1,3-dioxan-2-yl)oxy]propoxy]propyl-(1-methoxyethoxy)-di(propan-2-yl)silane |
| SMILES | CCC(OC(CC)[Si](OC(C)OC)(C(C)C)C(C)C)OC1(CC)OCCCO1 |
| InChI | InChI=1S/C21H44O6Si/c1-10-19(26-21(12-3)23-14-13-15-24-21)25-20(11-2)28(16(4)5,17(6)7)27-18(8)22-9/h16-20H,10-15H2,1-9H3 |
| InChIKey | HDASSPKSBUIZPF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|