C14H22O5 — CID 141341490
2-[(2-carboxy-4-methylpent-2-enoxy)methyl]-4-methylpent-2-enoic acid (PubChem CID 141341490) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-[(2-carboxy-4-methylpent-2-enoxy)methyl]-4-methylpent-2-enoic acid.
| Compound Name | 2-[(2-carboxy-4-methylpent-2-enoxy)methyl]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 141341490 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[(2-carboxy-4-methylpent-2-enoxy)methyl]-4-methylpent-2-enoic acid |
| SMILES | CC(C)C=C(COCC(=CC(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22O5/c1-9(2)5-11(13(15)16)7-19-8-12(14(17)18)6-10(3)4/h5-6,9-10H,7-8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | MVOICNTXYZMQTP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|