C17H23KO8 — CID 158424596
potassium;(E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate;(E)-3-formyl-5-methylhex-3-enoic acid (PubChem CID 158424596) has the molecular formula C17H23KO8 and a molecular weight of 394.46 g/mol. Its IUPAC name is potassium;(E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate;(E)-3-formyl-5-methylhex-3-enoic acid.
| Compound Name | potassium;(E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate;(E)-3-formyl-5-methylhex-3-enoic acid |
|---|---|
| PubChem CID | 158424596 |
| Molecular Formula | C17H23KO8 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | potassium;(E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate;(E)-3-formyl-5-methylhex-3-enoic acid |
| SMILES | CC(C)/C=C(/C=O)CC(=O)O.CC(C)/C=C(\CC(=O)O)C(=O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C9H12O5.C8H12O3.K/c1-5(2)3-6(4-7(10)11)8(12)9(13)14;1-6(2)3-7(5-9)4-8(10)11;/h3,5H,4H2,1-2H3,(H,10,11)(H,13,14);3,5-6H,4H2,1-2H3,(H,10,11);/q;;+1/p-1/b6-3+;7-3+; |
| InChIKey | SEFLOTWAMGCGJP-IIKORSTLSA-M |
| XLogP | -2.39 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|