C9H11O5- — CID 140698683
(E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate (PubChem CID 140698683) has the molecular formula C9H11O5- and a molecular weight of 199.18 g/mol. Its IUPAC name is (E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate.
| Compound Name | (E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate |
|---|---|
| PubChem CID | 140698683 |
| Molecular Formula | C9H11O5- |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (E)-3-(carboxymethyl)-5-methyl-2-oxohex-3-enoate |
| SMILES | CC(C)/C=C(\CC(=O)O)C(=O)C(=O)[O-] |
| InChI | InChI=1S/C9H12O5/c1-5(2)3-6(4-7(10)11)8(12)9(13)14/h3,5H,4H2,1-2H3,(H,10,11)(H,13,14)/p-1/b6-3+ |
| InChIKey | XOSZVBNRQGKJSV-ZZXKWVIFSA-M |
| XLogP | -0.64 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|