4-methyl-3,5-dioxopentanoic acid

C6H8O4 — CID 57040126

IUPAC4-methyl-3,5-dioxopentanoic acid
SMILESCC(C=O)C(=O)CC(=O)O
InChIInChI=1S/C6H8O4/c1-4(3-7)5(8)2-6(9)10/h3-4H,2H2,1H3,(H,9,10)
InChIKeyIPXBZKAXVKVJAY-UHFFFAOYSA-N
MW144.13 g/mol
LogP-0.13
Rot. Bonds4

About 4-methyl-3,5-dioxopentanoic acid

4-methyl-3,5-dioxopentanoic acid (PubChem CID 57040126) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is 4-methyl-3,5-dioxopentanoic acid.

Molecular Properties

Compound Name4-methyl-3,5-dioxopentanoic acid
PubChem CID57040126
Molecular FormulaC6H8O4
Molecular Weight144.13 g/mol
Exact Mass144.04
IUPAC Name4-methyl-3,5-dioxopentanoic acid
SMILESCC(C=O)C(=O)CC(=O)O
InChIInChI=1S/C6H8O4/c1-4(3-7)5(8)2-6(9)10/h3-4H,2H2,1H3,(H,9,10)
InChIKeyIPXBZKAXVKVJAY-UHFFFAOYSA-N
XLogP-0.13
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.13
LogP ≤ 5-0.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-methyl-3,5-dioxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-3,5-dioxopentanoic acid?
The IUPAC name of 4-methyl-3,5-dioxopentanoic acid (CID 57040126) is 4-methyl-3,5-dioxopentanoic acid.
What is the SMILES notation for 4-methyl-3,5-dioxopentanoic acid?
The canonical SMILES for 4-methyl-3,5-dioxopentanoic acid is CC(C=O)C(=O)CC(=O)O.
What is the InChIKey of 4-methyl-3,5-dioxopentanoic acid?
The InChIKey is IPXBZKAXVKVJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-4(3-7)5(8)2-6(9)10/h3-4H,2H2,1H3,(H,9,10).
What are the key properties of 4-methyl-3,5-dioxopentanoic acid?
4-methyl-3,5-dioxopentanoic acid has a molecular weight of 144.13 g/mol, XLogP of -0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,5-dioxopentanoic acid is sourced from PubChem (CID 57040126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).