5,5-dihydroxy-4-methyl-3-oxoheptanoic acid

C8H14O5 — CID 142640199

IUPAC5,5-dihydroxy-4-methyl-3-oxoheptanoic acid
SMILESCCC(O)(O)C(C)C(=O)CC(=O)O
InChIInChI=1S/C8H14O5/c1-3-8(12,13)5(2)6(9)4-7(10)11/h5,12-13H,3-4H2,1-2H3,(H,10,11)
InChIKeyZWAKCMBUQIPICG-UHFFFAOYSA-N
MW190.19 g/mol
LogP-0.24
Rot. Bonds5

About 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid

5,5-dihydroxy-4-methyl-3-oxoheptanoic acid (PubChem CID 142640199) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid.

Molecular Properties

Compound Name5,5-dihydroxy-4-methyl-3-oxoheptanoic acid
PubChem CID142640199
Molecular FormulaC8H14O5
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Name5,5-dihydroxy-4-methyl-3-oxoheptanoic acid
SMILESCCC(O)(O)C(C)C(=O)CC(=O)O
InChIInChI=1S/C8H14O5/c1-3-8(12,13)5(2)6(9)4-7(10)11/h5,12-13H,3-4H2,1-2H3,(H,10,11)
InChIKeyZWAKCMBUQIPICG-UHFFFAOYSA-N
XLogP-0.24
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 5-0.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid?
The IUPAC name of 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid (CID 142640199) is 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid.
What is the SMILES notation for 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid?
The canonical SMILES for 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid is CCC(O)(O)C(C)C(=O)CC(=O)O.
What is the InChIKey of 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid?
The InChIKey is ZWAKCMBUQIPICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-3-8(12,13)5(2)6(9)4-7(10)11/h5,12-13H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid?
5,5-dihydroxy-4-methyl-3-oxoheptanoic acid has a molecular weight of 190.19 g/mol, XLogP of -0.24, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dihydroxy-4-methyl-3-oxoheptanoic acid is sourced from PubChem (CID 142640199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).