About 2,4-dihydroxypentanal;3-oxobutanoic acid
2,4-dihydroxypentanal;3-oxobutanoic acid (PubChem CID 170430094) has the molecular formula C9H16O6
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2,4-dihydroxypentanal;3-oxobutanoic acid.
Molecular Properties
| Compound Name | 2,4-dihydroxypentanal;3-oxobutanoic acid |
| PubChem CID | 170430094 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2,4-dihydroxypentanal;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.CC(O)CC(O)C=O |
| InChI | InChI=1S/C5H10O3.C4H6O3/c1-4(7)2-5(8)3-6;1-3(5)2-4(6)7/h3-5,7-8H,2H2,1H3;2H2,1H3,(H,6,7) |
| InChIKey | PCUWZUFELAKVPB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydroxypentanal;3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydroxypentanal;3-oxobutanoic acid?
The IUPAC name of 2,4-dihydroxypentanal;3-oxobutanoic acid (CID 170430094) is 2,4-dihydroxypentanal;3-oxobutanoic acid.
What is the SMILES notation for 2,4-dihydroxypentanal;3-oxobutanoic acid?
The canonical SMILES for 2,4-dihydroxypentanal;3-oxobutanoic acid is CC(=O)CC(=O)O.CC(O)CC(O)C=O.
What is the InChIKey of 2,4-dihydroxypentanal;3-oxobutanoic acid?
The InChIKey is PCUWZUFELAKVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H6O3/c1-4(7)2-5(8)3-6;1-3(5)2-4(6)7/h3-5,7-8H,2H2,1H3;2H2,1H3,(H,6,7).
What are the key properties of 2,4-dihydroxypentanal;3-oxobutanoic acid?
2,4-dihydroxypentanal;3-oxobutanoic acid has a molecular weight of 220.22 g/mol, XLogP of -0.63, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxypentanal;3-oxobutanoic acid is sourced from PubChem (CID 170430094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).