C18H29N3O5 — CID 141342392
(2R,3S)-N,2-dihydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]oxy-5-methylhexanamide (PubChem CID 141342392) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2R,3S)-N,2-dihydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]oxy-5-methylhexanamide.
| Compound Name | (2R,3S)-N,2-dihydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]oxy-5-methylhexanamide |
|---|---|
| PubChem CID | 141342392 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2R,3S)-N,2-dihydroxy-3-[4-(4-methoxyphenyl)piperazin-1-yl]oxy-5-methylhexanamide |
| SMILES | COc1ccc(N2CCN(O[C@@H](CC(C)C)[C@@H](O)C(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O5/c1-13(2)12-16(17(22)18(23)19-24)26-21-10-8-20(9-11-21)14-4-6-15(25-3)7-5-14/h4-7,13,16-17,22,24H,8-12H2,1-3H3,(H,19,23)/t16-,17+/m0/s1 |
| InChIKey | NZUYXEXYEHROQJ-DLBZAZTESA-N |
| XLogP | 1.03 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|