C24H33N3O5 — CID 11597435
(2S,3S)-N,2-dihydroxy-3-[(2R)-4-(6-methoxynaphthalen-2-yl)-2-methylpiperazine-1-carbonyl]-5-methylhexanamide (PubChem CID 11597435) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2S,3S)-N,2-dihydroxy-3-[(2R)-4-(6-methoxynaphthalen-2-yl)-2-methylpiperazine-1-carbonyl]-5-methylhexanamide.
| Compound Name | (2S,3S)-N,2-dihydroxy-3-[(2R)-4-(6-methoxynaphthalen-2-yl)-2-methylpiperazine-1-carbonyl]-5-methylhexanamide |
|---|---|
| PubChem CID | 11597435 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (2S,3S)-N,2-dihydroxy-3-[(2R)-4-(6-methoxynaphthalen-2-yl)-2-methylpiperazine-1-carbonyl]-5-methylhexanamide |
| SMILES | COc1ccc2cc(N3CCN(C(=O)[C@@H](CC(C)C)[C@H](O)C(=O)NO)[C@H](C)C3)ccc2c1 |
| InChI | InChI=1S/C24H33N3O5/c1-15(2)11-21(22(28)23(29)25-31)24(30)27-10-9-26(14-16(27)3)19-7-5-18-13-20(32-4)8-6-17(18)12-19/h5-8,12-13,15-16,21-22,28,31H,9-11,14H2,1-4H3,(H,25,29)/t16-,21+,22+/m1/s1 |
| InChIKey | RSWIVOYKKFQUPX-XGRCMKMKSA-N |
| XLogP | 2.41 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|