C19H28ClN3O4 — CID 11618194
(2S,3S)-3-[(2R)-4-(4-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 11618194) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-4-(4-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[(2R)-4-(4-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 11618194 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2S,3S)-3-[(2R)-4-(4-chlorophenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCN(c2ccc(Cl)cc2)C[C@H]1C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C19H28ClN3O4/c1-12(2)10-16(17(24)18(25)21-27)19(26)23-9-8-22(11-13(23)3)15-6-4-14(20)5-7-15/h4-7,12-13,16-17,24,27H,8-11H2,1-3H3,(H,21,25)/t13-,16+,17+/m1/s1 |
| InChIKey | BGZMZUIWSDVKTP-COXVUDFISA-N |
| XLogP | 1.91 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|