C21H33N3O6 — CID 143172592
(2S)-3-[4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 143172592) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is (2S)-3-[4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S)-3-[4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 143172592 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (2S)-3-[4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | COc1ccc(N2CCN(C(=O)C(CC(C)C)[C@H](O)C(=O)NO)C(C)C2)cc1OC |
| InChI | InChI=1S/C21H33N3O6/c1-13(2)10-16(19(25)20(26)22-28)21(27)24-9-8-23(12-14(24)3)15-6-7-17(29-4)18(11-15)30-5/h6-7,11,13-14,16,19,25,28H,8-10,12H2,1-5H3,(H,22,26)/t14?,16?,19-/m0/s1 |
| InChIKey | QZTGELZTNGTCHL-KJXMEXGPSA-N |
| XLogP | 1.27 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|