C16H22N2O5 — CID 69098618
4-[3-methoxy-4-(oxetan-3-yloxy)phenyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 69098618) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[3-methoxy-4-(oxetan-3-yloxy)phenyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | 4-[3-methoxy-4-(oxetan-3-yloxy)phenyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69098618 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[3-methoxy-4-(oxetan-3-yloxy)phenyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | COc1cc(N2CCN(C(=O)O)C(C)C2)ccc1OC1COC1 |
| InChI | InChI=1S/C16H22N2O5/c1-11-8-17(5-6-18(11)16(19)20)12-3-4-14(15(7-12)21-2)23-13-9-22-10-13/h3-4,7,11,13H,5-6,8-10H2,1-2H3,(H,19,20) |
| InChIKey | BRAHCZFAWRMQTP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|