C22H30N4O4 — CID 140522547
N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-4-quinolin-3-ylpiperazine-1-carbonyl]hexanamide (PubChem CID 140522547) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-4-quinolin-3-ylpiperazine-1-carbonyl]hexanamide.
| Compound Name | N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-4-quinolin-3-ylpiperazine-1-carbonyl]hexanamide |
|---|---|
| PubChem CID | 140522547 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-4-quinolin-3-ylpiperazine-1-carbonyl]hexanamide |
| SMILES | CC(C)CC(C(=O)N1CCN(c2cnc3ccccc3c2)C[C@H]1C)C(O)C(=O)NO |
| InChI | InChI=1S/C22H30N4O4/c1-14(2)10-18(20(27)21(28)24-30)22(29)26-9-8-25(13-15(26)3)17-11-16-6-4-5-7-19(16)23-12-17/h4-7,11-12,14-15,18,20,27,30H,8-10,13H2,1-3H3,(H,24,28)/t15-,18?,20?/m1/s1 |
| InChIKey | JWKFAZIASWBOPL-MYWSLZCHSA-N |
| XLogP | 1.80 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|