C19H26FN3O4 — CID 11523743
(2S,3S)-3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 11523743) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is (2S,3S)-3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 11523743 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2S,3S)-3-[5-(4-fluorophenyl)-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CC2CC1CN2c1ccc(F)cc1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C19H26FN3O4/c1-11(2)7-16(17(24)18(25)21-27)19(26)23-10-14-8-15(23)9-22(14)13-5-3-12(20)4-6-13/h3-6,11,14-17,24,27H,7-10H2,1-2H3,(H,21,25)/t14?,15?,16-,17-/m0/s1 |
| InChIKey | IXSOMRRAFSTBDN-GQGLESIBSA-N |
| XLogP | 1.14 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|