C21H30F3N3O5 — CID 87837003
(2S,3S)-N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbonyl]hexanamide (PubChem CID 87837003) has the molecular formula C21H30F3N3O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is (2S,3S)-N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbonyl]hexanamide.
| Compound Name | (2S,3S)-N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbonyl]hexanamide |
|---|---|
| PubChem CID | 87837003 |
| Molecular Formula | C21H30F3N3O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (2S,3S)-N,2-dihydroxy-5-methyl-3-[(2R)-2-methyl-2-[4-(2,2,2-trifluoroethoxy)phenyl]piperazine-1-carbonyl]hexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCNC[C@@]1(C)c1ccc(OCC(F)(F)F)cc1)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C21H30F3N3O5/c1-13(2)10-16(17(28)18(29)26-31)19(30)27-9-8-25-11-20(27,3)14-4-6-15(7-5-14)32-12-21(22,23)24/h4-7,13,16-17,25,28,31H,8-12H2,1-3H3,(H,26,29)/t16-,17-,20-/m0/s1 |
| InChIKey | QLCLHLRCKJWMES-ZWOKBUDYSA-N |
| XLogP | 1.80 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|