C13H19NO3 — CID 141343517
(2E,4E)-N-(1,3-dioxol-4-ylmethyl)nona-2,4-dienamide (PubChem CID 141343517) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2E,4E)-N-(1,3-dioxol-4-ylmethyl)nona-2,4-dienamide.
| Compound Name | (2E,4E)-N-(1,3-dioxol-4-ylmethyl)nona-2,4-dienamide |
|---|---|
| PubChem CID | 141343517 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2E,4E)-N-(1,3-dioxol-4-ylmethyl)nona-2,4-dienamide |
| SMILES | CCCC/C=C/C=C/C(=O)NCC1=COCO1 |
| InChI | InChI=1S/C13H19NO3/c1-2-3-4-5-6-7-8-13(15)14-9-12-10-16-11-17-12/h5-8,10H,2-4,9,11H2,1H3,(H,14,15)/b6-5+,8-7+ |
| InChIKey | NSKTWZVDDMLAHO-BSWSSELBSA-N |
| XLogP | 2.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|