C14H23NO3 — CID 123566981
N-(1,3-dioxolan-2-ylmethyl)-3-methylnona-2,4-dienamide (PubChem CID 123566981) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-3-methylnona-2,4-dienamide.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-3-methylnona-2,4-dienamide |
|---|---|
| PubChem CID | 123566981 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-3-methylnona-2,4-dienamide |
| SMILES | CCCCC=CC(C)=CC(=O)NCC1OCCO1 |
| InChI | InChI=1S/C14H23NO3/c1-3-4-5-6-7-12(2)10-13(16)15-11-14-17-8-9-18-14/h6-7,10,14H,3-5,8-9,11H2,1-2H3,(H,15,16) |
| InChIKey | AERXKMQYOGNKOQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|