C26H28FN3O3 — CID 141344676
methyl 3-[(4-acetamidocyclohexyl)methylamino]-2-(4-fluorophenyl)quinoline-6-carboxylate (PubChem CID 141344676) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is methyl 3-[(4-acetamidocyclohexyl)methylamino]-2-(4-fluorophenyl)quinoline-6-carboxylate.
| Compound Name | methyl 3-[(4-acetamidocyclohexyl)methylamino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344676 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | methyl 3-[(4-acetamidocyclohexyl)methylamino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccc(F)cc3)c(NCC3CCC(NC(C)=O)CC3)cc2c1 |
| InChI | InChI=1S/C26H28FN3O3/c1-16(31)29-22-10-3-17(4-11-22)15-28-24-14-20-13-19(26(32)33-2)7-12-23(20)30-25(24)18-5-8-21(27)9-6-18/h5-9,12-14,17,22,28H,3-4,10-11,15H2,1-2H3,(H,29,31) |
| InChIKey | MALASXFELABYBG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |