C21H21FN2O2 — CID 141344700
methyl 3-[[(2S)-butan-2-yl]amino]-2-(4-fluorophenyl)quinoline-6-carboxylate (PubChem CID 141344700) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl 3-[[(2S)-butan-2-yl]amino]-2-(4-fluorophenyl)quinoline-6-carboxylate.
| Compound Name | methyl 3-[[(2S)-butan-2-yl]amino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344700 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | methyl 3-[[(2S)-butan-2-yl]amino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
| SMILES | CC[C@H](C)Nc1cc2cc(C(=O)OC)ccc2nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O2/c1-4-13(2)23-19-12-16-11-15(21(25)26-3)7-10-18(16)24-20(19)14-5-8-17(22)9-6-14/h5-13,23H,4H2,1-3H3/t13-/m0/s1 |
| InChIKey | HXDJTDOUWISUQZ-ZDUSSCGKSA-N |
| XLogP | 5.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |