C23H23FN2O2 — CID 141344743
methyl 3-[cyclopentyl(methyl)amino]-2-(4-fluorophenyl)quinoline-6-carboxylate (PubChem CID 141344743) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is methyl 3-[cyclopentyl(methyl)amino]-2-(4-fluorophenyl)quinoline-6-carboxylate.
| Compound Name | methyl 3-[cyclopentyl(methyl)amino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 141344743 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl 3-[cyclopentyl(methyl)amino]-2-(4-fluorophenyl)quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccc(F)cc3)c(N(C)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C23H23FN2O2/c1-26(19-5-3-4-6-19)21-14-17-13-16(23(27)28-2)9-12-20(17)25-22(21)15-7-10-18(24)11-8-15/h7-14,19H,3-6H2,1-2H3 |
| InChIKey | QCMZEGDIKPQTMB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |