C6H11NO — CID 141345236
[(1S,3R,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methanol (PubChem CID 141345236) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is [(1S,3R,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methanol.
| Compound Name | [(1S,3R,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methanol |
|---|---|
| PubChem CID | 141345236 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | [(1S,3R,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methanol |
| SMILES | OC[C@H]1C[C@@H]2C[C@@H]2N1 |
| InChI | InChI=1S/C6H11NO/c8-3-5-1-4-2-6(4)7-5/h4-8H,1-3H2/t4-,5-,6+/m1/s1 |
| InChIKey | ATOUVICHTLDTFN-PBXRRBTRSA-N |
| XLogP | -0.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |