C9H15NO3 — CID 170366864
3-[[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid (PubChem CID 170366864) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-[[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 170366864 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-[[(1S,3S,5S)-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid |
| SMILES | O=C(O)CCOC[C@@H]1C[C@@H]2C[C@@H]2N1 |
| InChI | InChI=1S/C9H15NO3/c11-9(12)1-2-13-5-7-3-6-4-8(6)10-7/h6-8,10H,1-5H2,(H,11,12)/t6-,7+,8+/m1/s1 |
| InChIKey | LKLCVEOBFMWWJE-CSMHCCOUSA-N |
| XLogP | 0.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|