C12H21NO3 — CID 170196684
3-[[(1R,3S,5R)-2-propan-2-yl-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid (PubChem CID 170196684) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-[[(1R,3S,5R)-2-propan-2-yl-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(1R,3S,5R)-2-propan-2-yl-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 170196684 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-[[(1R,3S,5R)-2-propan-2-yl-2-azabicyclo[3.1.0]hexan-3-yl]methoxy]propanoic acid |
| SMILES | CC(C)N1[C@H](COCCC(=O)O)C[C@H]2C[C@H]21 |
| InChI | InChI=1S/C12H21NO3/c1-8(2)13-10(5-9-6-11(9)13)7-16-4-3-12(14)15/h8-11H,3-7H2,1-2H3,(H,14,15)/t9-,10-,11+/m0/s1 |
| InChIKey | GRQCGWVOEVIPRF-GARJFASQSA-N |
| XLogP | 1.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|