C11H23NO3 — CID 163118409
2-tert-butyl-4,6-bis(hydroxymethyl)piperidin-3-ol (PubChem CID 163118409) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-tert-butyl-4,6-bis(hydroxymethyl)piperidin-3-ol.
| Compound Name | 2-tert-butyl-4,6-bis(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 163118409 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2-tert-butyl-4,6-bis(hydroxymethyl)piperidin-3-ol |
| SMILES | CC(C)(C)C1NC(CO)CC(CO)C1O |
| InChI | InChI=1S/C11H23NO3/c1-11(2,3)10-9(15)7(5-13)4-8(6-14)12-10/h7-10,12-15H,4-6H2,1-3H3 |
| InChIKey | LRQDPXALNRGGQO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |