About 3-but-2-enoyloxyphthalic acid
3-but-2-enoyloxyphthalic acid (PubChem CID 141345984) has the molecular formula C12H10O6
and a molecular weight of 250.21 g/mol. Its IUPAC name is 3-but-2-enoyloxyphthalic acid.
Molecular Properties
| Compound Name | 3-but-2-enoyloxyphthalic acid |
| PubChem CID | 141345984 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-but-2-enoyloxyphthalic acid |
| SMILES | CC=CC(=O)Oc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C12H10O6/c1-2-4-9(13)18-8-6-3-5-7(11(14)15)10(8)12(16)17/h2-6H,1H3,(H,14,15)(H,16,17) |
| InChIKey | BXOSZPKZECVHMN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-enoyloxyphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-enoyloxyphthalic acid?
The IUPAC name of 3-but-2-enoyloxyphthalic acid (CID 141345984) is 3-but-2-enoyloxyphthalic acid.
What is the SMILES notation for 3-but-2-enoyloxyphthalic acid?
The canonical SMILES for 3-but-2-enoyloxyphthalic acid is CC=CC(=O)Oc1cccc(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-but-2-enoyloxyphthalic acid?
The InChIKey is BXOSZPKZECVHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O6/c1-2-4-9(13)18-8-6-3-5-7(11(14)15)10(8)12(16)17/h2-6H,1H3,(H,14,15)(H,16,17).
What are the key properties of 3-but-2-enoyloxyphthalic acid?
3-but-2-enoyloxyphthalic acid has a molecular weight of 250.21 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-enoyloxyphthalic acid is sourced from PubChem (CID 141345984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).