C13H8O12 — CID 174868761
2-(2,3-dicarboxyphenoxy)-2-oxoethane-1,1,1-tricarboxylic acid (PubChem CID 174868761) has the molecular formula C13H8O12 and a molecular weight of 356.20 g/mol. Its IUPAC name is 2-(2,3-dicarboxyphenoxy)-2-oxoethane-1,1,1-tricarboxylic acid.
| Compound Name | 2-(2,3-dicarboxyphenoxy)-2-oxoethane-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 174868761 |
| Molecular Formula | C13H8O12 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-(2,3-dicarboxyphenoxy)-2-oxoethane-1,1,1-tricarboxylic acid |
| SMILES | O=C(O)c1cccc(OC(=O)C(C(=O)O)(C(=O)O)C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C13H8O12/c14-7(15)4-2-1-3-5(6(4)8(16)17)25-12(24)13(9(18)19,10(20)21)11(22)23/h1-3H,(H,14,15)(H,16,17)(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | QOFUDQKTXOTTGU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 212.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|