C19H12O12 — CID 150297049
3-[dicarboxy-(2,3-dicarboxyphenyl)methyl]phthalic acid (PubChem CID 150297049) has the molecular formula C19H12O12 and a molecular weight of 432.29 g/mol. Its IUPAC name is 3-[dicarboxy-(2,3-dicarboxyphenyl)methyl]phthalic acid.
| Compound Name | 3-[dicarboxy-(2,3-dicarboxyphenyl)methyl]phthalic acid |
|---|---|
| PubChem CID | 150297049 |
| Molecular Formula | C19H12O12 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 3-[dicarboxy-(2,3-dicarboxyphenyl)methyl]phthalic acid |
| SMILES | O=C(O)c1cccc(C(C(=O)O)(C(=O)O)c2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H12O12/c20-13(21)7-3-1-5-9(11(7)15(24)25)19(17(28)29,18(30)31)10-6-2-4-8(14(22)23)12(10)16(26)27/h1-6H,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | GIUOFXNELDXLDW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|