C17H12O10 — CID 166559177
3-[(2,3-dicarboxyphenoxy)methoxy]phthalic acid (PubChem CID 166559177) has the molecular formula C17H12O10 and a molecular weight of 376.27 g/mol. Its IUPAC name is 3-[(2,3-dicarboxyphenoxy)methoxy]phthalic acid.
| Compound Name | 3-[(2,3-dicarboxyphenoxy)methoxy]phthalic acid |
|---|---|
| PubChem CID | 166559177 |
| Molecular Formula | C17H12O10 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3-[(2,3-dicarboxyphenoxy)methoxy]phthalic acid |
| SMILES | O=C(O)c1cccc(OCOc2cccc(C(=O)O)c2C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C17H12O10/c18-14(19)8-3-1-5-10(12(8)16(22)23)26-7-27-11-6-2-4-9(15(20)21)13(11)17(24)25/h1-6H,7H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | FYXBXKYPSZYHCO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|