C19H22ClN2O9P — CID 14134624
[5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-phenylmethoxycarbonylphosphinic acid (PubChem CID 14134624) has the molecular formula C19H22ClN2O9P and a molecular weight of 488.82 g/mol. Its IUPAC name is [5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-phenylmethoxycarbonylphosphinic acid.
| Compound Name | [5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-phenylmethoxycarbonylphosphinic acid |
|---|---|
| PubChem CID | 14134624 |
| Molecular Formula | C19H22ClN2O9P |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-phenylmethoxycarbonylphosphinic acid |
| SMILES | O=C(OCc1ccccc1)P(=O)(O)OCC1OC(n2cc(CCCl)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C19H22ClN2O9P/c20-7-6-13-9-22(18(25)21-17(13)24)16-8-14(23)15(31-16)11-30-32(27,28)19(26)29-10-12-4-2-1-3-5-12/h1-5,9,14-16,23H,6-8,10-11H2,(H,27,28)(H,21,24,25) |
| InChIKey | QFBVZOHVLJFYMK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|