C14H20ClN2O9P — CID 5272138
[(2R,3S,5R)-5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl]oxy-ethoxycarbonylphosphinic acid (PubChem CID 5272138) has the molecular formula C14H20ClN2O9P and a molecular weight of 426.75 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl]oxy-ethoxycarbonylphosphinic acid.
| Compound Name | [(2R,3S,5R)-5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl]oxy-ethoxycarbonylphosphinic acid |
|---|---|
| PubChem CID | 5272138 |
| Molecular Formula | C14H20ClN2O9P |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [(2R,3S,5R)-5-[5-(2-chloroethyl)-2,4-dioxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl]oxy-ethoxycarbonylphosphinic acid |
| SMILES | CCOC(=O)P(=O)(O)O[C@H]1C[C@H](n2cc(CCCl)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C14H20ClN2O9P/c1-2-24-14(21)27(22,23)26-9-5-11(25-10(9)7-18)17-6-8(3-4-15)12(19)16-13(17)20/h6,9-11,18H,2-5,7H2,1H3,(H,22,23)(H,16,19,20)/t9-,10+,11+/m0/s1 |
| InChIKey | HKFATXMBDOKNHI-HBNTYKKESA-N |
| XLogP | 0.32 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|