About benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate
benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate (PubChem CID 141347115) has the molecular formula C15H11BrN2O2
and a molecular weight of 331.17 g/mol. Its IUPAC name is benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate |
| PubChem CID | 141347115 |
| Molecular Formula | C15H11BrN2O2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cnc2cc(Br)[nH]c2c1 |
| InChI | InChI=1S/C15H11BrN2O2/c16-14-7-12-13(18-14)6-11(8-17-12)15(19)20-9-10-4-2-1-3-5-10/h1-8,18H,9H2 |
| InChIKey | DFUOMVHSLRCIEN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate?
The IUPAC name of benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate (CID 141347115) is benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate.
What is the SMILES notation for benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate?
The canonical SMILES for benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate is O=C(OCc1ccccc1)c1cnc2cc(Br)[nH]c2c1.
What is the InChIKey of benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate?
The InChIKey is DFUOMVHSLRCIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrN2O2/c16-14-7-12-13(18-14)6-11(8-17-12)15(19)20-9-10-4-2-1-3-5-10/h1-8,18H,9H2.
What are the key properties of benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate?
benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate has a molecular weight of 331.17 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate is sourced from PubChem (CID 141347115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).