C19H24O3 — CID 141347714
1-methyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 141347714) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-methyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 1-methyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 141347714 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-methyl-3-oxo-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC1=CC(=O)C=C2CCC3C(CCC4C(C(=O)O)CCC43)C12 |
| InChI | InChI=1S/C19H24O3/c1-10-8-12(20)9-11-2-3-14-13-5-7-17(19(21)22)15(13)4-6-16(14)18(10)11/h8-9,13-18H,2-7H2,1H3,(H,21,22) |
| InChIKey | JLKFAAHQRZGPSS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |