C18H24O — CID 141172175
1-methyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 141172175) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-methyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 1-methyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141172175 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-methyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1=CC(=O)C=C2CCC3C4CCCC4CCC3C12 |
| InChI | InChI=1S/C18H24O/c1-11-9-14(19)10-13-6-7-16-15-4-2-3-12(15)5-8-17(16)18(11)13/h9-10,12,15-18H,2-8H2,1H3 |
| InChIKey | WKFSXNDMJVELJB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |