C17H24O2 — CID 140556506
(8S,9R,10S,13S,14R)-1-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 140556506) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (8S,9R,10S,13S,14R)-1-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14R)-1-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 140556506 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (8S,9R,10S,13S,14R)-1-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | O=C1C=C2CC[C@H]3[C@@H]4CCC[C@H]4CC[C@H]3[C@@H]2C(O)C1 |
| InChI | InChI=1S/C17H24O2/c18-12-8-11-5-6-14-13-3-1-2-10(13)4-7-15(14)17(11)16(19)9-12/h8,10,13-17,19H,1-7,9H2/t10-,13+,14-,15+,16?,17+/m0/s1 |
| InChIKey | LKFXXGYUNRZGTM-AEHONCESSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |