C19H35P — CID 141347867
cyclopenta-2,4-dien-1-yl(diheptyl)phosphane (PubChem CID 141347867) has the molecular formula C19H35P and a molecular weight of 294.46 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl(diheptyl)phosphane.
| Compound Name | cyclopenta-2,4-dien-1-yl(diheptyl)phosphane |
|---|---|
| PubChem CID | 141347867 |
| Molecular Formula | C19H35P |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl(diheptyl)phosphane |
| SMILES | CCCCCCCP(CCCCCCC)C1C=CC=C1 |
| InChI | InChI=1S/C19H35P/c1-3-5-7-9-13-17-20(19-15-11-12-16-19)18-14-10-8-6-4-2/h11-12,15-16,19H,3-10,13-14,17-18H2,1-2H3 |
| InChIKey | ANFKIMOKTDNKFQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|