C10H14N2O3S — CID 141350629
N-[3-(2-formyl-3-pyridinyl)propyl]methanesulfonamide (PubChem CID 141350629) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-[3-(2-formyl-3-pyridinyl)propyl]methanesulfonamide.
| Compound Name | N-[3-(2-formyl-3-pyridinyl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 141350629 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-[3-(2-formyl-3-pyridinyl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCc1cccnc1C=O |
| InChI | InChI=1S/C10H14N2O3S/c1-16(14,15)12-7-3-5-9-4-2-6-11-10(9)8-13/h2,4,6,8,12H,3,5,7H2,1H3 |
| InChIKey | VQDPFNBWHOZLPN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|