C18H18N6 — CID 141350806
2-(4-anilino-1,3,5-triazin-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 141350806) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(4-anilino-1,3,5-triazin-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(4-anilino-1,3,5-triazin-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 141350806 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-(4-anilino-1,3,5-triazin-2-yl)-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | Nc1cccc2c1CCN(c1ncnc(Nc3ccccc3)n1)C2 |
| InChI | InChI=1S/C18H18N6/c19-16-8-4-5-13-11-24(10-9-15(13)16)18-21-12-20-17(23-18)22-14-6-2-1-3-7-14/h1-8,12H,9-11,19H2,(H,20,21,22,23) |
| InChIKey | UPDRVEUZIRMATR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|