C21H32O6 — CID 141353538
4-O-butyl 1-O-(1,3-diethoxypropan-2-yl) 2-ethylbenzene-1,4-dicarboxylate (PubChem CID 141353538) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 4-O-butyl 1-O-(1,3-diethoxypropan-2-yl) 2-ethylbenzene-1,4-dicarboxylate.
| Compound Name | 4-O-butyl 1-O-(1,3-diethoxypropan-2-yl) 2-ethylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 141353538 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-O-butyl 1-O-(1,3-diethoxypropan-2-yl) 2-ethylbenzene-1,4-dicarboxylate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OC(COCC)COCC)c(CC)c1 |
| InChI | InChI=1S/C21H32O6/c1-5-9-12-26-20(22)17-10-11-19(16(6-2)13-17)21(23)27-18(14-24-7-3)15-25-8-4/h10-11,13,18H,5-9,12,14-15H2,1-4H3 |
| InChIKey | CBNOXPMRGZBIFC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|