C20H18O4 — CID 141356079
[1,3-dioxo-2-(3-propylphenyl)inden-2-yl] acetate (PubChem CID 141356079) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is [1,3-dioxo-2-(3-propylphenyl)inden-2-yl] acetate.
| Compound Name | [1,3-dioxo-2-(3-propylphenyl)inden-2-yl] acetate |
|---|---|
| PubChem CID | 141356079 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [1,3-dioxo-2-(3-propylphenyl)inden-2-yl] acetate |
| SMILES | CCCc1cccc(C2(OC(C)=O)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H18O4/c1-3-7-14-8-6-9-15(12-14)20(24-13(2)21)18(22)16-10-4-5-11-17(16)19(20)23/h4-6,8-12H,3,7H2,1-2H3 |
| InChIKey | OMGIJJVSRGOQAQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|