C13H18FN3O3S — CID 141356624
2-[(4-ethyl-2-oxopiperazin-1-yl)methyl]-4-fluorobenzenesulfonamide (PubChem CID 141356624) has the molecular formula C13H18FN3O3S and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(4-ethyl-2-oxopiperazin-1-yl)methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-[(4-ethyl-2-oxopiperazin-1-yl)methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 141356624 |
| Molecular Formula | C13H18FN3O3S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[(4-ethyl-2-oxopiperazin-1-yl)methyl]-4-fluorobenzenesulfonamide |
| SMILES | CCN1CCN(Cc2cc(F)ccc2S(N)(=O)=O)C(=O)C1 |
| InChI | InChI=1S/C13H18FN3O3S/c1-2-16-5-6-17(13(18)9-16)8-10-7-11(14)3-4-12(10)21(15,19)20/h3-4,7H,2,5-6,8-9H2,1H3,(H2,15,19,20) |
| InChIKey | GPQNCBAFOPMNLZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |