C20H14ClN5O2S — CID 141356993
4-[4-[(3-chlorophenyl)carbamoylamino]thieno[3,2-d]pyrimidin-7-yl]benzamide (PubChem CID 141356993) has the molecular formula C20H14ClN5O2S and a molecular weight of 423.89 g/mol. Its IUPAC name is 4-[4-[(3-chlorophenyl)carbamoylamino]thieno[3,2-d]pyrimidin-7-yl]benzamide.
| Compound Name | 4-[4-[(3-chlorophenyl)carbamoylamino]thieno[3,2-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 141356993 |
| Molecular Formula | C20H14ClN5O2S |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 4-[4-[(3-chlorophenyl)carbamoylamino]thieno[3,2-d]pyrimidin-7-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2csc3c(NC(=O)Nc4cccc(Cl)c4)ncnc23)cc1 |
| InChI | InChI=1S/C20H14ClN5O2S/c21-13-2-1-3-14(8-13)25-20(28)26-19-17-16(23-10-24-19)15(9-29-17)11-4-6-12(7-5-11)18(22)27/h1-10H,(H2,22,27)(H2,23,24,25,26,28) |
| InChIKey | NWMQJJWEAMTVPY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |