C20H20N2O5Se — CID 141357402
N-[[4-(4-methoxyphenyl)-1,3-selenazol-2-yl]-(3,4,5-trimethoxyphenyl)methylidene]hydroxylamine (PubChem CID 141357402) has the molecular formula C20H20N2O5Se and a molecular weight of 447.35 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)-1,3-selenazol-2-yl]-(3,4,5-trimethoxyphenyl)methylidene]hydroxylamine.
| Compound Name | N-[[4-(4-methoxyphenyl)-1,3-selenazol-2-yl]-(3,4,5-trimethoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 141357402 |
| Molecular Formula | C20H20N2O5Se |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)-1,3-selenazol-2-yl]-(3,4,5-trimethoxyphenyl)methylidene]hydroxylamine |
| SMILES | COc1ccc(-c2c[se]c(C(=NO)c3cc(OC)c(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C20H20N2O5Se/c1-24-14-7-5-12(6-8-14)15-11-28-20(21-15)18(22-23)13-9-16(25-2)19(27-4)17(10-13)26-3/h5-11,23H,1-4H3 |
| InChIKey | KWMCOFDPTQRHAS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|