C16H12O3S — CID 141358173
3-ethylsulfanylbenzo[d][2]benzoxepine-5,7-dione (PubChem CID 141358173) has the molecular formula C16H12O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-ethylsulfanylbenzo[d][2]benzoxepine-5,7-dione.
| Compound Name | 3-ethylsulfanylbenzo[d][2]benzoxepine-5,7-dione |
|---|---|
| PubChem CID | 141358173 |
| Molecular Formula | C16H12O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-ethylsulfanylbenzo[d][2]benzoxepine-5,7-dione |
| SMILES | CCSc1ccc2c(c1)c(=O)oc(=O)c1ccccc12 |
| InChI | InChI=1S/C16H12O3S/c1-2-20-10-7-8-12-11-5-3-4-6-13(11)15(17)19-16(18)14(12)9-10/h3-9H,2H2,1H3 |
| InChIKey | WJRUCYZBRDWIEU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |